N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide
Chemical Structure Depiction of
N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide
N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide
Compound characteristics
| Compound ID: | 1683-0714 |
| Compound Name: | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide |
| Molecular Weight: | 370.47 |
| Molecular Formula: | C23 H18 N2 O S |
| Smiles: | Cc1ccc2c(c1)sc(c1ccc(cc1)NC(/C=C/c1ccccc1)=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 6.1152 |
| logD: | 6.1152 |
| logSw: | -5.5438 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.565 |
| InChI Key: | VKRHCMKYGDBDPC-UHFFFAOYSA-N |