ethyl 2-(3,4-dichlorobenzamido)benzoate
Chemical Structure Depiction of
ethyl 2-(3,4-dichlorobenzamido)benzoate
ethyl 2-(3,4-dichlorobenzamido)benzoate
Compound characteristics
| Compound ID: | 1683-5127 |
| Compound Name: | ethyl 2-(3,4-dichlorobenzamido)benzoate |
| Molecular Weight: | 338.19 |
| Molecular Formula: | C16 H13 Cl2 N O3 |
| Smiles: | CCOC(c1ccccc1NC(c1ccc(c(c1)[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7714 |
| logD: | 2.8321 |
| logSw: | -4.8391 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.386 |
| InChI Key: | OOPXYDOYGSQDRK-UHFFFAOYSA-N |