N-(4-chloro-2,5-dimethoxyphenyl)-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-(4-chloro-2,5-dimethoxyphenyl)-3,4,5-trimethoxybenzamide
N-(4-chloro-2,5-dimethoxyphenyl)-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 1683-5562 |
| Compound Name: | N-(4-chloro-2,5-dimethoxyphenyl)-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 381.81 |
| Molecular Formula: | C18 H20 Cl N O6 |
| Smiles: | COc1cc(c(cc1NC(c1cc(c(c(c1)OC)OC)OC)=O)OC)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.2886 |
| logD: | 3.256 |
| logSw: | -3.5492 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.87 |
| InChI Key: | IEDPPUZDACCCIR-UHFFFAOYSA-N |