N-(2-bromo-4-methylphenyl)-4-methylbenzamide
Chemical Structure Depiction of
N-(2-bromo-4-methylphenyl)-4-methylbenzamide
N-(2-bromo-4-methylphenyl)-4-methylbenzamide
Compound characteristics
| Compound ID: | 1683-6225 |
| Compound Name: | N-(2-bromo-4-methylphenyl)-4-methylbenzamide |
| Molecular Weight: | 304.18 |
| Molecular Formula: | C15 H14 Br N O |
| Smiles: | Cc1ccc(cc1)C(Nc1ccc(C)cc1[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4239 |
| logD: | 4.4228 |
| logSw: | -4.2831 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.6318 |
| InChI Key: | PIZVSMUCSWOALO-UHFFFAOYSA-N |