N-(3-chloro-2-methylphenyl)-3-(4-chlorophenyl)prop-2-enamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-3-(4-chlorophenyl)prop-2-enamide
N-(3-chloro-2-methylphenyl)-3-(4-chlorophenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 1683-6408 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-3-(4-chlorophenyl)prop-2-enamide |
| Molecular Weight: | 306.19 |
| Molecular Formula: | C16 H13 Cl2 N O |
| Smiles: | Cc1c(cccc1[Cl])NC(/C=C/c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3987 |
| logD: | 5.3984 |
| logSw: | -6.0896 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.4184 |
| InChI Key: | UVNPPYLIZQSYLG-UHFFFAOYSA-N |