2-{2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl}-6-methylpyrimidin-4(3H)-one
Chemical Structure Depiction of
2-{2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl}-6-methylpyrimidin-4(3H)-one
2-{2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl}-6-methylpyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | 1683-6807 |
| Compound Name: | 2-{2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl}-6-methylpyrimidin-4(3H)-one |
| Molecular Weight: | 288.3 |
| Molecular Formula: | C14 H16 N4 O3 |
| Smiles: | CC1=CC(NC(N/N=C/c2cccc(c2OC)OC)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6202 |
| logD: | 1.57 |
| logSw: | -2.0113 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.928 |
| InChI Key: | LNLSKBCODVOBTA-UHFFFAOYSA-N |