2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1-benzothiophen-3(2H)-one
Chemical Structure Depiction of
2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1-benzothiophen-3(2H)-one
2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1-benzothiophen-3(2H)-one
Compound characteristics
| Compound ID: | 1690-0088 |
| Compound Name: | 2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1-benzothiophen-3(2H)-one |
| Molecular Weight: | 373.26 |
| Molecular Formula: | C19 H10 Cl2 O2 S |
| Smiles: | C(=C1/C(c2ccccc2S1)=O)\c1ccc(c2ccc(c(c2)[Cl])[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 6.4122 |
| logD: | 6.4122 |
| logSw: | -6.4047 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 20.9697 |
| InChI Key: | ZKZPAFSZMQHXPW-UHFFFAOYSA-N |