2-{[(2-chloro-5-nitrophenyl)methylidene]amino}-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-{[(2-chloro-5-nitrophenyl)methylidene]amino}-1H-isoindole-1,3(2H)-dione
2-{[(2-chloro-5-nitrophenyl)methylidene]amino}-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | 1699-1450 |
| Compound Name: | 2-{[(2-chloro-5-nitrophenyl)methylidene]amino}-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 329.7 |
| Molecular Formula: | C15 H8 Cl N3 O4 |
| Smiles: | C(\c1cc(ccc1[Cl])[N+]([O-])=O)=N/N1C(c2ccccc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3308 |
| logD: | 3.3308 |
| logSw: | -3.7824 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 73.288 |
| InChI Key: | HKKAJYQKDOSXKD-UHFFFAOYSA-N |