ethyl {[3-cyano-6-(2,4-dimethylphenyl)-4-phenylpyridin-2-yl]sulfanyl}acetate
Chemical Structure Depiction of
ethyl {[3-cyano-6-(2,4-dimethylphenyl)-4-phenylpyridin-2-yl]sulfanyl}acetate
ethyl {[3-cyano-6-(2,4-dimethylphenyl)-4-phenylpyridin-2-yl]sulfanyl}acetate
Compound characteristics
| Compound ID: | 1702-0092 |
| Compound Name: | ethyl {[3-cyano-6-(2,4-dimethylphenyl)-4-phenylpyridin-2-yl]sulfanyl}acetate |
| Molecular Weight: | 402.51 |
| Molecular Formula: | C24 H22 N2 O2 S |
| Smiles: | CCOC(CSc1c(C#N)c(cc(c2ccc(C)cc2C)n1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4869 |
| logD: | 6.4869 |
| logSw: | -5.6593 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.658 |
| InChI Key: | VZEGOPWBPUPYGQ-UHFFFAOYSA-N |