4-chloro-N-{2-[2-(3-methyl-4-oxonaphthalen-1(4H)-ylidene)hydrazinecarbonyl]phenyl}benzamide
Chemical Structure Depiction of
4-chloro-N-{2-[2-(3-methyl-4-oxonaphthalen-1(4H)-ylidene)hydrazinecarbonyl]phenyl}benzamide
4-chloro-N-{2-[2-(3-methyl-4-oxonaphthalen-1(4H)-ylidene)hydrazinecarbonyl]phenyl}benzamide
Compound characteristics
| Compound ID: | 1704-0639 |
| Compound Name: | 4-chloro-N-{2-[2-(3-methyl-4-oxonaphthalen-1(4H)-ylidene)hydrazinecarbonyl]phenyl}benzamide |
| Molecular Weight: | 443.89 |
| Molecular Formula: | C25 H18 Cl N3 O3 |
| Smiles: | CC1=C/C(c2ccccc2C1=O)=N/NC(c1ccccc1NC(c1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9088 |
| logD: | 3.5738 |
| logSw: | -5.0519 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.316 |
| InChI Key: | ICGFCSKMQUUTAH-UHFFFAOYSA-N |