N'-(3-phenylprop-2-en-1-ylidene)-2-[(pyridin-2-yl)sulfanyl]acetohydrazide
Chemical Structure Depiction of
N'-(3-phenylprop-2-en-1-ylidene)-2-[(pyridin-2-yl)sulfanyl]acetohydrazide
N'-(3-phenylprop-2-en-1-ylidene)-2-[(pyridin-2-yl)sulfanyl]acetohydrazide
Compound characteristics
| Compound ID: | 1761-1325 |
| Compound Name: | N'-(3-phenylprop-2-en-1-ylidene)-2-[(pyridin-2-yl)sulfanyl]acetohydrazide |
| Molecular Weight: | 297.38 |
| Molecular Formula: | C16 H15 N3 O S |
| Smiles: | C(C(N/N=C/C=C/c1ccccc1)=O)Sc1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 2.6351 |
| logD: | 2.6348 |
| logSw: | -2.8825 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.381 |
| InChI Key: | GTHBIDPZLIYMBG-UHFFFAOYSA-N |