N'-[(2,4-dimethoxyphenyl)methylidene]-4-methoxybenzohydrazide
Chemical Structure Depiction of
N'-[(2,4-dimethoxyphenyl)methylidene]-4-methoxybenzohydrazide
N'-[(2,4-dimethoxyphenyl)methylidene]-4-methoxybenzohydrazide
Compound characteristics
| Compound ID: | 1761-2012 |
| Compound Name: | N'-[(2,4-dimethoxyphenyl)methylidene]-4-methoxybenzohydrazide |
| Molecular Weight: | 314.34 |
| Molecular Formula: | C17 H18 N2 O4 |
| Smiles: | COc1ccc(cc1)C(N/N=C/c1ccc(cc1OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3076 |
| logD: | 3.3066 |
| logSw: | -3.5849 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.272 |
| InChI Key: | AKPIAVQYRMUSMC-UHFFFAOYSA-N |