3-chloro-N-(2,4-dichlorophenyl)-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-(2,4-dichlorophenyl)-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide
3-chloro-N-(2,4-dichlorophenyl)-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide
Compound characteristics
| Compound ID: | 1762-0029 |
| Compound Name: | 3-chloro-N-(2,4-dichlorophenyl)-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| Molecular Weight: | 485.68 |
| Molecular Formula: | C20 H10 Cl3 F3 N4 O |
| Smiles: | c1ccc(cc1)c1cc(C(F)(F)F)n2c(c(c(C(Nc3ccc(cc3[Cl])[Cl])=O)n2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 6.6192 |
| logD: | 6.398 |
| logSw: | -6.6354 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.108 |
| InChI Key: | ZJROEDXXOTUXAN-UHFFFAOYSA-N |