N-(3,5-dichlorophenyl)-4-methylbenzamide
Chemical Structure Depiction of
N-(3,5-dichlorophenyl)-4-methylbenzamide
N-(3,5-dichlorophenyl)-4-methylbenzamide
Compound characteristics
| Compound ID: | 1763-0306 |
| Compound Name: | N-(3,5-dichlorophenyl)-4-methylbenzamide |
| Molecular Weight: | 280.15 |
| Molecular Formula: | C14 H11 Cl2 N O |
| Smiles: | Cc1ccc(cc1)C(Nc1cc(cc(c1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9748 |
| logD: | 4.6491 |
| logSw: | -5.0672 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3296 |
| InChI Key: | MVSVJTNRTHIRTQ-UHFFFAOYSA-N |