N-(2,5-dimethylphenyl)-4-methylbenzamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-4-methylbenzamide
N-(2,5-dimethylphenyl)-4-methylbenzamide
Compound characteristics
| Compound ID: | 1763-0309 |
| Compound Name: | N-(2,5-dimethylphenyl)-4-methylbenzamide |
| Molecular Weight: | 239.31 |
| Molecular Formula: | C16 H17 N O |
| Smiles: | Cc1ccc(cc1)C(Nc1cc(C)ccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6837 |
| logD: | 3.6836 |
| logSw: | -3.8021 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.6318 |
| InChI Key: | KQSKHOJXLMYJKH-UHFFFAOYSA-N |