2-chloro-N-(3,4-dimethylphenyl)benzamide
Chemical Structure Depiction of
2-chloro-N-(3,4-dimethylphenyl)benzamide
2-chloro-N-(3,4-dimethylphenyl)benzamide
Compound characteristics
| Compound ID: | 1763-0393 |
| Compound Name: | 2-chloro-N-(3,4-dimethylphenyl)benzamide |
| Molecular Weight: | 259.73 |
| Molecular Formula: | C15 H14 Cl N O |
| Smiles: | Cc1ccc(cc1C)NC(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4634 |
| logD: | 4.4629 |
| logSw: | -4.554 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3296 |
| InChI Key: | JSBARNARTCXPMV-UHFFFAOYSA-N |