1-(4-chlorophenyl)-N-[1-(prop-2-en-1-yl)-1H-benzimidazol-2-yl]methanimine
Chemical Structure Depiction of
1-(4-chlorophenyl)-N-[1-(prop-2-en-1-yl)-1H-benzimidazol-2-yl]methanimine
1-(4-chlorophenyl)-N-[1-(prop-2-en-1-yl)-1H-benzimidazol-2-yl]methanimine
Compound characteristics
| Compound ID: | 1770-0132 |
| Compound Name: | 1-(4-chlorophenyl)-N-[1-(prop-2-en-1-yl)-1H-benzimidazol-2-yl]methanimine |
| Molecular Weight: | 295.77 |
| Molecular Formula: | C17 H14 Cl N3 |
| Smiles: | C=CCn1c2ccccc2nc1/N=C/c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.7107 |
| logD: | 4.7107 |
| logSw: | -5.3323 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 20.4519 |
| InChI Key: | SVCLLGNNSSQZNX-UHFFFAOYSA-N |