ethyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}benzoate
Chemical Structure Depiction of
ethyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}benzoate
ethyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | 1778-2826 |
| Compound Name: | ethyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}benzoate |
| Molecular Weight: | 384.82 |
| Molecular Formula: | C20 H17 Cl N2 O4 |
| Smiles: | CCOC(c1ccccc1NC(c1c(c2ccccc2[Cl])noc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3188 |
| logD: | 3.879 |
| logSw: | -4.7203 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.346 |
| InChI Key: | GOLGJFVOYUZGCS-UHFFFAOYSA-N |