N,N-dibenzyl-4-butoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N,N-dibenzyl-4-butoxybenzene-1-sulfonamide
N,N-dibenzyl-4-butoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 1786-0024 |
| Compound Name: | N,N-dibenzyl-4-butoxybenzene-1-sulfonamide |
| Molecular Weight: | 409.55 |
| Molecular Formula: | C24 H27 N O3 S |
| Smiles: | CCCCOc1ccc(cc1)S(N(Cc1ccccc1)Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0397 |
| logD: | 6.0397 |
| logSw: | -5.5037 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.76 |
| InChI Key: | QYLVZKMVAVPQMR-UHFFFAOYSA-N |