N-{2-[2-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-2-oxoethyl}-2-phenylacetamide
Chemical Structure Depiction of
N-{2-[2-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-2-oxoethyl}-2-phenylacetamide
N-{2-[2-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-2-oxoethyl}-2-phenylacetamide
Compound characteristics
| Compound ID: | 1805-1326 |
| Compound Name: | N-{2-[2-(5-nitro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinyl]-2-oxoethyl}-2-phenylacetamide |
| Molecular Weight: | 381.35 |
| Molecular Formula: | C18 H15 N5 O5 |
| Smiles: | C(C(NCC(N/N=C1C(Nc2ccc(cc\12)[N+]([O-])=O)=O)=O)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 1.7888 |
| logD: | 1.7829 |
| logSw: | -2.7867 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 117.004 |
| InChI Key: | VWYSXANUUCKQPE-UHFFFAOYSA-N |