N-(4-{[(5-benzyl-3-bromo-2-hydroxyphenyl)methylidene]amino}phenyl)-2,4-dichlorobenzamide
Chemical Structure Depiction of
N-(4-{[(5-benzyl-3-bromo-2-hydroxyphenyl)methylidene]amino}phenyl)-2,4-dichlorobenzamide
N-(4-{[(5-benzyl-3-bromo-2-hydroxyphenyl)methylidene]amino}phenyl)-2,4-dichlorobenzamide
Compound characteristics
| Compound ID: | 1812-0951 |
| Compound Name: | N-(4-{[(5-benzyl-3-bromo-2-hydroxyphenyl)methylidene]amino}phenyl)-2,4-dichlorobenzamide |
| Molecular Weight: | 554.27 |
| Molecular Formula: | C27 H19 Br Cl2 N2 O2 |
| Smiles: | C(c1ccccc1)c1cc(/C=N/c2ccc(cc2)NC(c2ccc(cc2[Cl])[Cl])=O)c(c(c1)[Br])O |
| Stereo: | ACHIRAL |
| logP: | 7.6103 |
| logD: | 7.2826 |
| logSw: | -6.2364 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 46.665 |
| InChI Key: | DFEWBBZEXLTZOQ-UHFFFAOYSA-N |