3-(2,6-dichlorophenyl)-2-phenylprop-2-enenitrile
Chemical Structure Depiction of
3-(2,6-dichlorophenyl)-2-phenylprop-2-enenitrile
3-(2,6-dichlorophenyl)-2-phenylprop-2-enenitrile
Compound characteristics
| Compound ID: | 1844-0036 |
| Compound Name: | 3-(2,6-dichlorophenyl)-2-phenylprop-2-enenitrile |
| Molecular Weight: | 274.15 |
| Molecular Formula: | C15 H9 Cl2 N |
| Smiles: | C(=C(C#N)/c1ccccc1)\c1c(cccc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.2165 |
| logD: | 4.2165 |
| logSw: | -4.5667 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 17.0231 |
| InChI Key: | KJQCNVVCCLWWOT-UHFFFAOYSA-N |