2-(3-nitrophenyl)-2-oxoethyl 4-(2,3-dichloroanilino)-4-oxobutanoate
Chemical Structure Depiction of
2-(3-nitrophenyl)-2-oxoethyl 4-(2,3-dichloroanilino)-4-oxobutanoate
2-(3-nitrophenyl)-2-oxoethyl 4-(2,3-dichloroanilino)-4-oxobutanoate
Compound characteristics
| Compound ID: | 1885-0355 |
| Compound Name: | 2-(3-nitrophenyl)-2-oxoethyl 4-(2,3-dichloroanilino)-4-oxobutanoate |
| Molecular Weight: | 425.22 |
| Molecular Formula: | C18 H14 Cl2 N2 O6 |
| Smiles: | C(CC(=O)OCC(c1cccc(c1)[N+]([O-])=O)=O)C(Nc1cccc(c1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.6683 |
| logD: | 3.6464 |
| logSw: | -4.3267 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 89.581 |
| InChI Key: | QZQNPVGLZUWMEU-UHFFFAOYSA-N |