3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propyl 3-(3-nitrophenyl)prop-2-enoate
Chemical Structure Depiction of
3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propyl 3-(3-nitrophenyl)prop-2-enoate
3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propyl 3-(3-nitrophenyl)prop-2-enoate
Compound characteristics
| Compound ID: | 1889-0701 |
| Compound Name: | 3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propyl 3-(3-nitrophenyl)prop-2-enoate |
| Molecular Weight: | 380.36 |
| Molecular Formula: | C20 H16 N2 O6 |
| Smiles: | C(CN1C(c2ccccc2C1=O)=O)COC(/C=C/c1cccc(c1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.676 |
| logD: | 3.676 |
| logSw: | -3.988 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 83.304 |
| InChI Key: | AQFNJAUOMIKGEK-UHFFFAOYSA-N |