6-oxo-6H-dibenzo[b,d]pyran-3-yl 3-(2-chlorophenyl)prop-2-enoate
Chemical Structure Depiction of
6-oxo-6H-dibenzo[b,d]pyran-3-yl 3-(2-chlorophenyl)prop-2-enoate
6-oxo-6H-dibenzo[b,d]pyran-3-yl 3-(2-chlorophenyl)prop-2-enoate
Compound characteristics
| Compound ID: | 1889-0715 |
| Compound Name: | 6-oxo-6H-dibenzo[b,d]pyran-3-yl 3-(2-chlorophenyl)prop-2-enoate |
| Molecular Weight: | 376.79 |
| Molecular Formula: | C22 H13 Cl O4 |
| Smiles: | C(=C/c1ccccc1[Cl])\C(=O)Oc1ccc2c3ccccc3C(=O)Oc2c1 |
| Stereo: | ACHIRAL |
| logP: | 4.8125 |
| logD: | 4.8125 |
| logSw: | -5.0842 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.671 |
| InChI Key: | YWZFQCLYAIUKOD-UHFFFAOYSA-N |