N-(2,4-dimethoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-enamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-enamide
N-(2,4-dimethoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 1889-1018 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-enamide |
| Molecular Weight: | 343.38 |
| Molecular Formula: | C19 H21 N O5 |
| Smiles: | COc1ccc(c(/C=C/C(Nc2ccc(cc2OC)OC)=O)c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.7888 |
| logD: | 3.788 |
| logSw: | -4.0744 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.767 |
| InChI Key: | MRMNRKNRDVGILZ-UHFFFAOYSA-N |