N-[3-(3-methylphenoxy)-5-nitrophenyl]-2-phenylquinoline-4-carboxamide
Chemical Structure Depiction of
N-[3-(3-methylphenoxy)-5-nitrophenyl]-2-phenylquinoline-4-carboxamide
N-[3-(3-methylphenoxy)-5-nitrophenyl]-2-phenylquinoline-4-carboxamide
Compound characteristics
| Compound ID: | 1890-1486 |
| Compound Name: | N-[3-(3-methylphenoxy)-5-nitrophenyl]-2-phenylquinoline-4-carboxamide |
| Molecular Weight: | 475.5 |
| Molecular Formula: | C29 H21 N3 O4 |
| Smiles: | Cc1cccc(c1)Oc1cc(cc(c1)[N+]([O-])=O)NC(c1cc(c2ccccc2)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 7.7204 |
| logD: | 7.7199 |
| logSw: | -5.9674 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.518 |
| InChI Key: | PSEWGDZVCOCBTL-UHFFFAOYSA-N |