4-benzylidene-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-benzylidene-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one
4-benzylidene-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 1894-8992 |
| Compound Name: | 4-benzylidene-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 255.29 |
| Molecular Formula: | C14 H9 N O2 S |
| Smiles: | C(=C1/C(=O)OC(c2cccs2)=N1)\c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1391 |
| logD: | 3.1391 |
| logSw: | -3.3734 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.394 |
| InChI Key: | NRPOSXHPIULSKV-UHFFFAOYSA-N |