7-ethoxy-2-[(4-methylphenyl)imino]-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
7-ethoxy-2-[(4-methylphenyl)imino]-2H-1-benzopyran-3-carboxamide
7-ethoxy-2-[(4-methylphenyl)imino]-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | 1926-2340 |
| Compound Name: | 7-ethoxy-2-[(4-methylphenyl)imino]-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C19 H18 N2 O3 |
| Smiles: | CCOc1ccc2C=C(/C(=N/c3ccc(C)cc3)Oc2c1)C(N)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0453 |
| logD: | 3.0453 |
| logSw: | -3.2187 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.127 |
| InChI Key: | KKSPDYJJBAEYAO-UHFFFAOYSA-N |