N'-benzylidene-2-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)acetohydrazide
Chemical Structure Depiction of
N'-benzylidene-2-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)acetohydrazide
N'-benzylidene-2-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)acetohydrazide
Compound characteristics
| Compound ID: | 1988-0299 |
| Compound Name: | N'-benzylidene-2-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)acetohydrazide |
| Molecular Weight: | 273.25 |
| Molecular Formula: | C12 H11 N5 O3 |
| Smiles: | C(C1C(NC(NN=1)=O)=O)C(N/N=C/c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.0554 |
| logD: | 0.0439 |
| logSw: | -1.9708 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 95.912 |
| InChI Key: | PEFHGNDECNCHLI-UHFFFAOYSA-N |