N-(2-benzoyl-4-chlorophenyl)-2-(2,5-dichlorophenoxy)acetamide
Chemical Structure Depiction of
N-(2-benzoyl-4-chlorophenyl)-2-(2,5-dichlorophenoxy)acetamide
N-(2-benzoyl-4-chlorophenyl)-2-(2,5-dichlorophenoxy)acetamide
Compound characteristics
| Compound ID: | 1988-1113 |
| Compound Name: | N-(2-benzoyl-4-chlorophenyl)-2-(2,5-dichlorophenoxy)acetamide |
| Molecular Weight: | 434.7 |
| Molecular Formula: | C21 H14 Cl3 N O3 |
| Smiles: | C(C(Nc1ccc(cc1C(c1ccccc1)=O)[Cl])=O)Oc1cc(ccc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.0673 |
| logD: | 6.0613 |
| logSw: | -6.1448 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.471 |
| InChI Key: | RRPTXZBAULJDNY-UHFFFAOYSA-N |