3-phenyl-2-sulfanylidene-5-[(thiophen-2-yl)methylidene]-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-phenyl-2-sulfanylidene-5-[(thiophen-2-yl)methylidene]-1,3-thiazolidin-4-one
3-phenyl-2-sulfanylidene-5-[(thiophen-2-yl)methylidene]-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1988-1695 |
| Compound Name: | 3-phenyl-2-sulfanylidene-5-[(thiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
| Molecular Weight: | 303.42 |
| Molecular Formula: | C14 H9 N O S3 |
| Smiles: | C(=C1/C(N(C(=S)S1)c1ccccc1)=O)/c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 3.5053 |
| logD: | 3.5053 |
| logSw: | -3.667 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 16.8492 |
| InChI Key: | AVOLWSYTUDOYJG-UHFFFAOYSA-N |