2-methyl-N'-(phenoxyacetyl)benzohydrazide
Chemical Structure Depiction of
2-methyl-N'-(phenoxyacetyl)benzohydrazide
2-methyl-N'-(phenoxyacetyl)benzohydrazide
Compound characteristics
| Compound ID: | 1988-1930 |
| Compound Name: | 2-methyl-N'-(phenoxyacetyl)benzohydrazide |
| Molecular Weight: | 284.31 |
| Molecular Formula: | C16 H16 N2 O3 |
| Smiles: | Cc1ccccc1C(NNC(COc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2538 |
| logD: | 2.2381 |
| logSw: | -2.7945 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.72 |
| InChI Key: | TXZLFQXHOQHIAP-UHFFFAOYSA-N |