2-(4-bromophenoxy)-N-[4-(diethylamino)phenyl]acetamide
Chemical Structure Depiction of
2-(4-bromophenoxy)-N-[4-(diethylamino)phenyl]acetamide
2-(4-bromophenoxy)-N-[4-(diethylamino)phenyl]acetamide
Compound characteristics
| Compound ID: | 1988-1991 |
| Compound Name: | 2-(4-bromophenoxy)-N-[4-(diethylamino)phenyl]acetamide |
| Molecular Weight: | 377.28 |
| Molecular Formula: | C18 H21 Br N2 O2 |
| Smiles: | CCN(CC)c1ccc(cc1)NC(COc1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6995 |
| logD: | 4.5072 |
| logSw: | -4.338 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.352 |
| InChI Key: | ZFCOLUHJKACQOM-UHFFFAOYSA-N |