5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1996-0044 |
| Compound Name: | 5-({3-[(4-chlorophenyl)methoxy]phenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 375.89 |
| Molecular Formula: | C18 H14 Cl N O2 S2 |
| Smiles: | CN1C(/C(=C/c2cccc(c2)OCc2ccc(cc2)[Cl])SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4572 |
| logD: | 4.4572 |
| logSw: | -4.7371 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 23.7072 |
| InChI Key: | MYIYJLKVQXWUIR-UHFFFAOYSA-N |