3-benzyl-5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-benzyl-5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
3-benzyl-5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1996-0151 |
| Compound Name: | 3-benzyl-5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 398.54 |
| Molecular Formula: | C21 H22 N2 O2 S2 |
| Smiles: | CCN(CC)c1ccc(/C=C2/C(N(Cc3ccccc3)C(=S)S2)=O)c(c1)O |
| Stereo: | ACHIRAL |
| logP: | 4.984 |
| logD: | 4.9817 |
| logSw: | -4.2949 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.727 |
| InChI Key: | PTDFZLDAGLMJCC-UNOMPAQXSA-N |