5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1996-0170 |
| Compound Name: | 5-{[4-(diethylamino)-2-hydroxyphenyl]methylidene}-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 336.47 |
| Molecular Formula: | C16 H20 N2 O2 S2 |
| Smiles: | CCN(CC)c1ccc(/C=C2/C(N(CC)C(=S)S2)=O)c(c1)O |
| Stereo: | ACHIRAL |
| logP: | 3.6819 |
| logD: | 3.6796 |
| logSw: | -3.4914 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.723 |
| InChI Key: | KUGAHGGCNLNOTL-UHFFFAOYSA-N |