5-[(2,5-dimethoxyphenyl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(2,5-dimethoxyphenyl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one
5-[(2,5-dimethoxyphenyl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1996-0205 |
| Compound Name: | 5-[(2,5-dimethoxyphenyl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one |
| Molecular Weight: | 340.4 |
| Molecular Formula: | C18 H16 N2 O3 S |
| Smiles: | COc1ccc(c(/C=C2/C(N/C(=N/c3ccccc3)S2)=O)c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.4034 |
| logD: | 3.4033 |
| logSw: | -3.9283 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.327 |
| InChI Key: | PKRVZBCYVMQLMA-UHFFFAOYSA-N |