N-[(3-bromophenyl)methoxy]-1-(2,4-dichlorophenyl)methanimine
Chemical Structure Depiction of
N-[(3-bromophenyl)methoxy]-1-(2,4-dichlorophenyl)methanimine
N-[(3-bromophenyl)methoxy]-1-(2,4-dichlorophenyl)methanimine
Compound characteristics
| Compound ID: | 2017-2395 |
| Compound Name: | N-[(3-bromophenyl)methoxy]-1-(2,4-dichlorophenyl)methanimine |
| Molecular Weight: | 359.05 |
| Molecular Formula: | C14 H10 Br Cl2 N O |
| Smiles: | C(c1cccc(c1)[Br])O/N=C/c1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.9213 |
| logD: | 5.9213 |
| logSw: | -6.3221 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 17.3391 |
| InChI Key: | NEHDNBPDYYWXJN-UHFFFAOYSA-N |