2-chloro-N-[3-(4-chloro-2-nitroanilino)propyl]-4,5-difluorobenzamide
Chemical Structure Depiction of
2-chloro-N-[3-(4-chloro-2-nitroanilino)propyl]-4,5-difluorobenzamide
2-chloro-N-[3-(4-chloro-2-nitroanilino)propyl]-4,5-difluorobenzamide
Compound characteristics
| Compound ID: | 2023-0396 |
| Compound Name: | 2-chloro-N-[3-(4-chloro-2-nitroanilino)propyl]-4,5-difluorobenzamide |
| Molecular Weight: | 404.2 |
| Molecular Formula: | C16 H13 Cl2 F2 N3 O3 |
| Smiles: | C(CNC(c1cc(c(cc1[Cl])F)F)=O)CNc1ccc(cc1[N+]([O-])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4953 |
| logD: | 4.4952 |
| logSw: | -4.764 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.224 |
| InChI Key: | YAYHJVJADTZWKU-UHFFFAOYSA-N |