1-{2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl}-4-(2-nitrophenyl)piperazine--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-{2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl}-4-(2-nitrophenyl)piperazine--hydrogen chloride (1/1)
1-{2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl}-4-(2-nitrophenyl)piperazine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 2023-0448 |
| Compound Name: | 1-{2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl}-4-(2-nitrophenyl)piperazine--hydrogen chloride (1/1) |
| Molecular Weight: | 369.81 |
| Molecular Formula: | C15 H19 N5 O4 |
| Salt: | HCl |
| Smiles: | Cc1c(non1)OCCN1CCN(CC1)c1ccccc1[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.4603 |
| logD: | 1.8546 |
| logSw: | -2.3457 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 84.359 |
| InChI Key: | KZQXLWFLJRSIBS-UHFFFAOYSA-N |