N-[3-(2-chloro-4-nitroanilino)propyl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[3-(2-chloro-4-nitroanilino)propyl]-2-fluorobenzamide
N-[3-(2-chloro-4-nitroanilino)propyl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | 2023-0597 |
| Compound Name: | N-[3-(2-chloro-4-nitroanilino)propyl]-2-fluorobenzamide |
| Molecular Weight: | 351.76 |
| Molecular Formula: | C16 H15 Cl F N3 O3 |
| Smiles: | C(CNC(c1ccccc1F)=O)CNc1ccc(cc1[Cl])[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.5769 |
| logD: | 3.5769 |
| logSw: | -4.0612 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.525 |
| InChI Key: | WUPWKGIDQXDIDV-UHFFFAOYSA-N |