3-bromo-4-ethoxy-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
Chemical Structure Depiction of
3-bromo-4-ethoxy-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
3-bromo-4-ethoxy-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | 2026-3757 |
| Compound Name: | 3-bromo-4-ethoxy-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
| Molecular Weight: | 467.38 |
| Molecular Formula: | C23 H19 Br N2 O2 S |
| Smiles: | CCOc1ccc(cc1[Br])C(Nc1ccc(cc1)c1nc2ccc(C)cc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4382 |
| logD: | 6.4381 |
| logSw: | -5.5723 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.989 |
| InChI Key: | FTXWGHNUMSKVBD-UHFFFAOYSA-N |