N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-fluorobenzamide
Chemical Structure Depiction of
N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-fluorobenzamide
N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-fluorobenzamide
Compound characteristics
| Compound ID: | 2026-3981 |
| Compound Name: | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-fluorobenzamide |
| Molecular Weight: | 376.39 |
| Molecular Formula: | C22 H17 F N2 O3 |
| Smiles: | Cc1cc2c(cc1C)oc(c1cc(ccc1O)NC(c1ccc(cc1)F)=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 5.7825 |
| logD: | 5.7822 |
| logSw: | -5.3612 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.688 |
| InChI Key: | BMQFWMKABWNFPJ-UHFFFAOYSA-N |