N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]naphthalene-2-carboxamide
Chemical Structure Depiction of
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]naphthalene-2-carboxamide
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]naphthalene-2-carboxamide
Compound characteristics
| Compound ID: | 2026-4052 |
| Compound Name: | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]naphthalene-2-carboxamide |
| Molecular Weight: | 398.85 |
| Molecular Formula: | C24 H15 Cl N2 O2 |
| Smiles: | c1ccc2cc(ccc2c1)C(Nc1ccc(cc1)c1nc2cc(ccc2o1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.2397 |
| logD: | 6.2397 |
| logSw: | -6.6958 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.868 |
| InChI Key: | XBWYVDPILLICCM-UHFFFAOYSA-N |