3-[(3-chloro-4-methylanilino)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
3-[(3-chloro-4-methylanilino)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}-1,3-thiazolidine-2,4-dione
3-[(3-chloro-4-methylanilino)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 2027-0028 |
| Compound Name: | 3-[(3-chloro-4-methylanilino)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 404.94 |
| Molecular Formula: | C19 H17 Cl N2 O2 S2 |
| Smiles: | Cc1ccc(cc1[Cl])NCN1C(/C(=C\c2ccc(cc2)SC)SC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.1001 |
| logD: | 6.1001 |
| logSw: | -6.219 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.755 |
| InChI Key: | IKOXJRSVVFLNAR-UHFFFAOYSA-N |