3-(4-chlorophenyl)-5-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
3-(4-chlorophenyl)-5-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione
3-(4-chlorophenyl)-5-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 2027-0398 |
| Compound Name: | 3-(4-chlorophenyl)-5-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 450.73 |
| Molecular Formula: | C20 H10 Cl3 N O3 S |
| Smiles: | C(=C1/C(N(C(=O)S1)c1ccc(cc1)[Cl])=O)\c1ccc(c2ccc(c(c2)[Cl])[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 6.8229 |
| logD: | 6.8229 |
| logSw: | -6.8783 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.554 |
| InChI Key: | FDGXKDUVILDDEG-UHFFFAOYSA-N |