5-(4-nitrophenoxy)-2-(pyridin-2-yl)-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
5-(4-nitrophenoxy)-2-(pyridin-2-yl)-1H-isoindole-1,3(2H)-dione
5-(4-nitrophenoxy)-2-(pyridin-2-yl)-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | 2036-1358 |
| Compound Name: | 5-(4-nitrophenoxy)-2-(pyridin-2-yl)-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 361.31 |
| Molecular Formula: | C19 H11 N3 O5 |
| Smiles: | c1ccnc(c1)N1C(c2ccc(cc2C1=O)Oc1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9207 |
| logD: | 3.9207 |
| logSw: | -4.1259 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 77.52 |
| InChI Key: | RRQHMHBKEBHXPJ-UHFFFAOYSA-N |