N-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)prop-2-enamide
Chemical Structure Depiction of
N-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)prop-2-enamide
N-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 2042-2818 |
| Compound Name: | N-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)prop-2-enamide |
| Molecular Weight: | 322.19 |
| Molecular Formula: | C16 H13 Cl2 N O2 |
| Smiles: | COc1ccc(/C=C/C(Nc2ccc(cc2[Cl])[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9208 |
| logD: | 4.9098 |
| logSw: | -5.1866 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9622 |
| InChI Key: | RWIRXHDXDFNTQI-UHFFFAOYSA-N |