N-[3-(trifluoromethyl)phenyl][1,1'-biphenyl]-4-carboxamide
Chemical Structure Depiction of
N-[3-(trifluoromethyl)phenyl][1,1'-biphenyl]-4-carboxamide
N-[3-(trifluoromethyl)phenyl][1,1'-biphenyl]-4-carboxamide
Compound characteristics
| Compound ID: | 2042-3014 |
| Compound Name: | N-[3-(trifluoromethyl)phenyl][1,1'-biphenyl]-4-carboxamide |
| Molecular Weight: | 341.33 |
| Molecular Formula: | C20 H14 F3 N O |
| Smiles: | c1ccc(cc1)c1ccc(cc1)C(Nc1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7829 |
| logD: | 5.7689 |
| logSw: | -6.3059 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.058 |
| InChI Key: | KUEABHHFINTHSK-UHFFFAOYSA-N |